C18H17N3O5S — CID 9080759
[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl] (E)-but-2-enoate (PubChem CID 9080759) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is [2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl] (E)-but-2-enoate.
| Compound Name | [2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 9080759 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl] (E)-but-2-enoate |
| SMILES | C=CCN(C(=O)COC(=O)/C=C/C)c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C18H17N3O5S/c1-3-5-17(23)26-11-16(22)20(10-4-2)18-19-15(12-27-18)13-6-8-14(9-7-13)21(24)25/h3-9,12H,2,10-11H2,1H3/b5-3+ |
| InChIKey | CVIGAPYJKIBSIT-HWKANZROSA-N |
| XLogP | 3.36 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|