C19H14Cl2N4O4S — CID 27968789
N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-prop-2-enylacetamide (PubChem CID 27968789) has the molecular formula C19H14Cl2N4O4S and a molecular weight of 465.32 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-prop-2-enylacetamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 27968789 |
| Molecular Formula | C19H14Cl2N4O4S |
| Molecular Weight | 465.32 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[(2-nitro-3-pyridinyl)oxy]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)COc1cccnc1[N+](=O)[O-])c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C19H14Cl2N4O4S/c1-2-8-24(17(26)10-29-16-4-3-7-22-18(16)25(27)28)19-23-15(11-30-19)12-5-6-13(20)14(21)9-12/h2-7,9,11H,1,8,10H2 |
| InChIKey | JKMUJTNWKXGYDZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|