C20H23Cl2N3O2S — CID 55539128
N-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-3-oxopropyl]-2,2-dimethylpropanamide (PubChem CID 55539128) has the molecular formula C20H23Cl2N3O2S and a molecular weight of 440.40 g/mol. Its IUPAC name is N-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-3-oxopropyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-3-oxopropyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 55539128 |
| Molecular Formula | C20H23Cl2N3O2S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-3-oxopropyl]-2,2-dimethylpropanamide |
| SMILES | C=CCN(C(=O)CCNC(=O)C(C)(C)C)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C20H23Cl2N3O2S/c1-5-10-25(17(26)8-9-23-18(27)20(2,3)4)19-24-16(12-28-19)13-6-7-14(21)15(22)11-13/h5-7,11-12H,1,8-10H2,2-4H3,(H,23,27) |
| InChIKey | KENVTYMIFPIPAN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|