C21H19Cl2N3O2S2 — CID 55491633
3-acetamido-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enyl-3-thiophen-2-ylpropanamide (PubChem CID 55491633) has the molecular formula C21H19Cl2N3O2S2 and a molecular weight of 480.44 g/mol. Its IUPAC name is 3-acetamido-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enyl-3-thiophen-2-ylpropanamide.
| Compound Name | 3-acetamido-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enyl-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 55491633 |
| Molecular Formula | C21H19Cl2N3O2S2 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 3-acetamido-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enyl-3-thiophen-2-ylpropanamide |
| SMILES | C=CCN(C(=O)CC(NC(C)=O)c1cccs1)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C21H19Cl2N3O2S2/c1-3-8-26(20(28)11-17(24-13(2)27)19-5-4-9-29-19)21-25-18(12-30-21)14-6-7-15(22)16(23)10-14/h3-7,9-10,12,17H,1,8,11H2,2H3,(H,24,27) |
| InChIKey | MSMTXJJFRHDTIA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|