C16H13Cl2N3O3S — CID 55772503
N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-nitro-N-prop-2-enylcyclopropane-1-carboxamide (PubChem CID 55772503) has the molecular formula C16H13Cl2N3O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-nitro-N-prop-2-enylcyclopropane-1-carboxamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-nitro-N-prop-2-enylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55772503 |
| Molecular Formula | C16H13Cl2N3O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-nitro-N-prop-2-enylcyclopropane-1-carboxamide |
| SMILES | C=CCN(C(=O)C1CC1[N+](=O)[O-])c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C16H13Cl2N3O3S/c1-2-5-20(15(22)10-7-14(10)21(23)24)16-19-13(8-25-16)9-3-4-11(17)12(18)6-9/h2-4,6,8,10,14H,1,5,7H2 |
| InChIKey | UXSUHLJDFAEYNQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|