C20H21N4O4S+ — CID 8620737
furan-2-ylmethyl-methyl-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]azanium (PubChem CID 8620737) has the molecular formula C20H21N4O4S+ and a molecular weight of 413.48 g/mol. Its IUPAC name is furan-2-ylmethyl-methyl-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]azanium.
| Compound Name | furan-2-ylmethyl-methyl-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8620737 |
| Molecular Formula | C20H21N4O4S+ |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | furan-2-ylmethyl-methyl-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]azanium |
| SMILES | C=CCN(C(=O)C[NH+](C)Cc1ccco1)c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C20H20N4O4S/c1-3-10-23(19(25)13-22(2)12-17-5-4-11-28-17)20-21-18(14-29-20)15-6-8-16(9-7-15)24(26)27/h3-9,11,14H,1,10,12-13H2,2H3/p+1 |
| InChIKey | LBZHJIDKKBSCJP-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|