C22H21N3O3S — CID 8892618
N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclopentanecarboxamide (PubChem CID 8892618) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclopentanecarboxamide.
| Compound Name | N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 8892618 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclopentanecarboxamide |
| SMILES | Cc1cccc(N(C(=O)C2CCCC2)c2nc(-c3ccc([N+](=O)[O-])cc3)cs2)c1 |
| InChI | InChI=1S/C22H21N3O3S/c1-15-5-4-8-19(13-15)24(21(26)17-6-2-3-7-17)22-23-20(14-29-22)16-9-11-18(12-10-16)25(27)28/h4-5,8-14,17H,2-3,6-7H2,1H3 |
| InChIKey | IVIVGMQXMGVPRQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|