C16H10N4O2S — CID 135822805
2-(1H-benzimidazol-2-yl)-4-(3-nitrophenyl)-1,3-thiazole (PubChem CID 135822805) has the molecular formula C16H10N4O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-(3-nitrophenyl)-1,3-thiazole.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-(3-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 135822805 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-(3-nitrophenyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(-c3nc4ccccc4[nH]3)n2)c1 |
| InChI | InChI=1S/C16H10N4O2S/c21-20(22)11-5-3-4-10(8-11)14-9-23-16(19-14)15-17-12-6-1-2-7-13(12)18-15/h1-9H,(H,17,18) |
| InChIKey | UWDZHWPAGPYYDX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|