C15H11N3O4S2 — CID 3832891
2-[(6-nitro-2-sulfanylidene-1,3-benzothiazol-3-yl)methylamino]benzoic acid (PubChem CID 3832891) has the molecular formula C15H11N3O4S2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[(6-nitro-2-sulfanylidene-1,3-benzothiazol-3-yl)methylamino]benzoic acid.
| Compound Name | 2-[(6-nitro-2-sulfanylidene-1,3-benzothiazol-3-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 3832891 |
| Molecular Formula | C15H11N3O4S2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2-[(6-nitro-2-sulfanylidene-1,3-benzothiazol-3-yl)methylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NCn1c(=S)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H11N3O4S2/c19-14(20)10-3-1-2-4-11(10)16-8-17-12-6-5-9(18(21)22)7-13(12)24-15(17)23/h1-7,16H,8H2,(H,19,20) |
| InChIKey | GSDKCANZAZMWQO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|