C24H16ClF2N3O2S — CID 23854296
6-[3-[(3-chlorophenyl)methyl]-2-(2,4-difluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23854296) has the molecular formula C24H16ClF2N3O2S and a molecular weight of 483.93 g/mol. Its IUPAC name is 6-[3-[(3-chlorophenyl)methyl]-2-(2,4-difluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[(3-chlorophenyl)methyl]-2-(2,4-difluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23854296 |
| Molecular Formula | C24H16ClF2N3O2S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 6-[3-[(3-chlorophenyl)methyl]-2-(2,4-difluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3cs/c(=N\c4ccc(F)cc4F)n3Cc3cccc(Cl)c3)cc2N1 |
| InChI | InChI=1S/C24H16ClF2N3O2S/c25-16-3-1-2-14(8-16)11-30-21(15-4-7-22-20(9-15)28-23(31)12-32-22)13-33-24(30)29-19-6-5-17(26)10-18(19)27/h1-10,13H,11-12H2,(H,28,31)/b29-24- |
| InChIKey | KAILXJGPSADXPF-OLFWJLLRSA-N |
| XLogP | 5.76 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|