C20H15F2N3O2S — CID 23734261
6-[2-(2,4-difluorophenyl)imino-3-prop-2-enyl-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23734261) has the molecular formula C20H15F2N3O2S and a molecular weight of 399.42 g/mol. Its IUPAC name is 6-[2-(2,4-difluorophenyl)imino-3-prop-2-enyl-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(2,4-difluorophenyl)imino-3-prop-2-enyl-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23734261 |
| Molecular Formula | C20H15F2N3O2S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 6-[2-(2,4-difluorophenyl)imino-3-prop-2-enyl-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | C=CCn1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\c1ccc(F)cc1F |
| InChI | InChI=1S/C20H15F2N3O2S/c1-2-7-25-17(12-3-6-18-16(8-12)23-19(26)10-27-18)11-28-20(25)24-15-5-4-13(21)9-14(15)22/h2-6,8-9,11H,1,7,10H2,(H,23,26)/b24-20- |
| InChIKey | UYUVWQZHFKNWOD-GFMRDNFCSA-N |
| XLogP | 4.24 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|