C12H8N2O3S — CID 16768078
2-[4-(4-cyanophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid (PubChem CID 16768078) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-(4-cyanophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 16768078 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-[4-(4-cyanophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid |
| SMILES | N#Cc1ccc(-c2csc(=O)n2CC(=O)O)cc1 |
| InChI | InChI=1S/C12H8N2O3S/c13-5-8-1-3-9(4-2-8)10-7-18-12(17)14(10)6-11(15)16/h1-4,7H,6H2,(H,15,16) |
| InChIKey | HEXCROVBSAQLLJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |