2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid

C11H8BrNO3S — CID 43286853

IUPAC2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid
SMILESO=C(O)Cn1c(-c2ccccc2Br)csc1=O
InChIInChI=1S/C11H8BrNO3S/c12-8-4-2-1-3-7(8)9-6-17-11(16)13(9)5-10(14)15/h1-4,6H,5H2,(H,14,15)
InChIKeyXDAWPRMUHPJMJJ-UHFFFAOYSA-N
MW314.16 g/mol
LogP2.42
Rot. Bonds3

About 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid

2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid (PubChem CID 43286853) has the molecular formula C11H8BrNO3S and a molecular weight of 314.16 g/mol. Its IUPAC name is 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid
PubChem CID43286853
Molecular FormulaC11H8BrNO3S
Molecular Weight314.16 g/mol
Exact Mass312.94
IUPAC Name2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid
SMILESO=C(O)Cn1c(-c2ccccc2Br)csc1=O
InChIInChI=1S/C11H8BrNO3S/c12-8-4-2-1-3-7(8)9-6-17-11(16)13(9)5-10(14)15/h1-4,6H,5H2,(H,14,15)
InChIKeyXDAWPRMUHPJMJJ-UHFFFAOYSA-N
XLogP2.42
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.16
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid?
The IUPAC name of 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid (CID 43286853) is 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid?
The canonical SMILES for 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid is O=C(O)Cn1c(-c2ccccc2Br)csc1=O.
What is the InChIKey of 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid?
The InChIKey is XDAWPRMUHPJMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO3S/c12-8-4-2-1-3-7(8)9-6-17-11(16)13(9)5-10(14)15/h1-4,6H,5H2,(H,14,15).
What are the key properties of 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid?
2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid has a molecular weight of 314.16 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-bromophenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid is sourced from PubChem (CID 43286853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).