C21H16ClN3O2S2 — CID 78801450
(5E)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 78801450) has the molecular formula C21H16ClN3O2S2 and a molecular weight of 441.97 g/mol. Its IUPAC name is (5E)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 78801450 |
| Molecular Formula | C21H16ClN3O2S2 |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | (5E)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cccc(-c2nc(/C=C3/NC(=S)N(Cc4ccccc4Cl)C3=O)cs2)c1 |
| InChI | InChI=1S/C21H16ClN3O2S2/c1-27-16-7-4-6-13(9-16)19-23-15(12-29-19)10-18-20(26)25(21(28)24-18)11-14-5-2-3-8-17(14)22/h2-10,12H,11H2,1H3,(H,24,28)/b18-10+ |
| InChIKey | NSKCASFVRBMZQY-VCHYOVAHSA-N |
| XLogP | 4.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|