C16H11N3O2S3 — CID 47077501
(5E)-3-(furan-2-ylmethyl)-2-sulfanylidene-5-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]imidazolidin-4-one (PubChem CID 47077501) has the molecular formula C16H11N3O2S3 and a molecular weight of 373.48 g/mol. Its IUPAC name is (5E)-3-(furan-2-ylmethyl)-2-sulfanylidene-5-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]imidazolidin-4-one.
| Compound Name | (5E)-3-(furan-2-ylmethyl)-2-sulfanylidene-5-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 47077501 |
| Molecular Formula | C16H11N3O2S3 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | (5E)-3-(furan-2-ylmethyl)-2-sulfanylidene-5-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylidene]imidazolidin-4-one |
| SMILES | O=C1/C(=C\c2csc(-c3ccsc3)n2)NC(=S)N1Cc1ccco1 |
| InChI | InChI=1S/C16H11N3O2S3/c20-15-13(18-16(22)19(15)7-12-2-1-4-21-12)6-11-9-24-14(17-11)10-3-5-23-8-10/h1-6,8-9H,7H2,(H,18,22)/b13-6+ |
| InChIKey | AOQSDEZGZXPIBB-AWNIVKPZSA-N |
| XLogP | 3.72 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|