C23H18BrClN2O4S — CID 19548182
(5E)-5-[[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548182) has the molecular formula C23H18BrClN2O4S and a molecular weight of 533.83 g/mol. Its IUPAC name is (5E)-5-[[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548182 |
| Molecular Formula | C23H18BrClN2O4S |
| Molecular Weight | 533.83 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | (5E)-5-[[3-[(2-bromo-4-chlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(Cc3ccco3)C2=O)cc1COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C23H18BrClN2O4S/c1-29-20-6-4-14(9-15(20)13-31-21-7-5-16(25)11-18(21)24)10-19-22(28)27(23(32)26-19)12-17-3-2-8-30-17/h2-11H,12-13H2,1H3,(H,26,32)/b19-10+ |
| InChIKey | XYTRZHYSGWHDPH-VXLYETTFSA-N |
| XLogP | 5.54 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.83 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|