C19H20N2O3S2 — CID 29093026
(5Z)-3-ethyl-5-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 29093026) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (5Z)-3-ethyl-5-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-ethyl-5-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 29093026 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (5Z)-3-ethyl-5-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OC)c(CSCc3ccco3)c2)NC1=S |
| InChI | InChI=1S/C19H20N2O3S2/c1-3-21-18(22)16(20-19(21)25)10-13-6-7-17(23-2)14(9-13)11-26-12-15-5-4-8-24-15/h4-10H,3,11-12H2,1-2H3,(H,20,25)/b16-10- |
| InChIKey | HBRCNNSOBBHIDR-YBEGLDIGSA-N |
| XLogP | 3.80 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|