C21H18Cl2N2O3S — CID 19548561
(5E)-3-cyclopropyl-5-[[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548561) has the molecular formula C21H18Cl2N2O3S and a molecular weight of 449.36 g/mol. Its IUPAC name is (5E)-3-cyclopropyl-5-[[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-cyclopropyl-5-[[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548561 |
| Molecular Formula | C21H18Cl2N2O3S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | (5E)-3-cyclopropyl-5-[[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(C3CC3)C2=O)cc1COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O3S/c1-27-18-6-2-12(9-17-20(26)25(15-4-5-15)21(29)24-17)8-13(18)11-28-19-7-3-14(22)10-16(19)23/h2-3,6-10,15H,4-5,11H2,1H3,(H,24,29)/b17-9+ |
| InChIKey | WCKPENIDCLPCHG-RQZCQDPDSA-N |
| XLogP | 4.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|