C20H14ClN3O2S — CID 76862577
N-(2-chlorophenyl)-2-cyano-3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide (PubChem CID 76862577) has the molecular formula C20H14ClN3O2S and a molecular weight of 395.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-cyano-3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide.
| Compound Name | N-(2-chlorophenyl)-2-cyano-3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 76862577 |
| Molecular Formula | C20H14ClN3O2S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-(2-chlorophenyl)-2-cyano-3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide |
| SMILES | COc1cccc(-c2nc(C=C(C#N)C(=O)Nc3ccccc3Cl)cs2)c1 |
| InChI | InChI=1S/C20H14ClN3O2S/c1-26-16-6-4-5-13(10-16)20-23-15(12-27-20)9-14(11-22)19(25)24-18-8-3-2-7-17(18)21/h2-10,12H,1H3,(H,24,25) |
| InChIKey | XVFYRKOTEAHVDW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|