C19H10Cl2FN3OS — CID 27718232
(E)-2-cyano-N-(2,4-dichlorophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide (PubChem CID 27718232) has the molecular formula C19H10Cl2FN3OS and a molecular weight of 418.28 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dichlorophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 27718232 |
| Molecular Formula | C19H10Cl2FN3OS |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1csc(-c2ccc(F)cc2)n1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H10Cl2FN3OS/c20-13-3-6-17(16(21)8-13)25-18(26)12(9-23)7-15-10-27-19(24-15)11-1-4-14(22)5-2-11/h1-8,10H,(H,25,26)/b12-7+ |
| InChIKey | CXYTYPDKCDOMEN-KPKJPENVSA-N |
| XLogP | 5.80 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|