C18H12FN3O2S — CID 27718484
(E)-2-cyano-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 27718484) has the molecular formula C18H12FN3O2S and a molecular weight of 353.38 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 27718484 |
| Molecular Formula | C18H12FN3O2S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (E)-2-cyano-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1csc(-c2ccc(F)cc2)n1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H12FN3O2S/c19-14-5-3-12(4-6-14)18-22-15(11-25-18)8-13(9-20)17(23)21-10-16-2-1-7-24-16/h1-8,11H,10H2,(H,21,23)/b13-8+ |
| InChIKey | GIMYKEOQSQAUSC-MDWZMJQESA-N |
| XLogP | 3.77 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|