C12H10N4O2 — CID 146025232
(E)-2-cyano-N-(furan-2-ylmethyl)-3-(1H-imidazol-5-yl)prop-2-enamide (PubChem CID 146025232) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is (E)-2-cyano-N-(furan-2-ylmethyl)-3-(1H-imidazol-5-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(furan-2-ylmethyl)-3-(1H-imidazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 146025232 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (E)-2-cyano-N-(furan-2-ylmethyl)-3-(1H-imidazol-5-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cnc[nH]1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H10N4O2/c13-5-9(4-10-6-14-8-16-10)12(17)15-7-11-2-1-3-18-11/h1-4,6,8H,7H2,(H,14,16)(H,15,17)/b9-4+ |
| InChIKey | GROLJMUULWXBII-RUDMXATFSA-N |
| XLogP | 1.23 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|