C22H18ClN3O2 — CID 50858106
(E)-N-(2-chlorophenyl)-2-cyano-3-[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]prop-2-enamide (PubChem CID 50858106) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is (E)-N-(2-chlorophenyl)-2-cyano-3-[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-chlorophenyl)-2-cyano-3-[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 50858106 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (E)-N-(2-chlorophenyl)-2-cyano-3-[1-(4-methoxyphenyl)-5-methylpyrrol-3-yl]prop-2-enamide |
| SMILES | COc1ccc(-n2cc(/C=C(\C#N)C(=O)Nc3ccccc3Cl)cc2C)cc1 |
| InChI | InChI=1S/C22H18ClN3O2/c1-15-11-16(14-26(15)18-7-9-19(28-2)10-8-18)12-17(13-24)22(27)25-21-6-4-3-5-20(21)23/h3-12,14H,1-2H3,(H,25,27)/b17-12+ |
| InChIKey | FNLKYTBOKGNBAI-SFQUDFHCSA-N |
| XLogP | 4.99 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|