C21H15Cl2N3O2 — CID 50855755
(E)-2-cyano-N-(3,4-dichlorophenyl)-3-[1-(4-methoxyphenyl)pyrrol-3-yl]prop-2-enamide (PubChem CID 50855755) has the molecular formula C21H15Cl2N3O2 and a molecular weight of 412.28 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,4-dichlorophenyl)-3-[1-(4-methoxyphenyl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,4-dichlorophenyl)-3-[1-(4-methoxyphenyl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 50855755 |
| Molecular Formula | C21H15Cl2N3O2 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | (E)-2-cyano-N-(3,4-dichlorophenyl)-3-[1-(4-methoxyphenyl)pyrrol-3-yl]prop-2-enamide |
| SMILES | COc1ccc(-n2ccc(/C=C(\C#N)C(=O)Nc3ccc(Cl)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C21H15Cl2N3O2/c1-28-18-5-3-17(4-6-18)26-9-8-14(13-26)10-15(12-24)21(27)25-16-2-7-19(22)20(23)11-16/h2-11,13H,1H3,(H,25,27)/b15-10+ |
| InChIKey | QDGABPAPNFJCRW-XNTDXEJSSA-N |
| XLogP | 5.34 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|