C20H15ClN4O2 — CID 9334097
(E)-N-(3-chloro-4-methoxyphenyl)-2-cyano-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 9334097) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is (E)-N-(3-chloro-4-methoxyphenyl)-2-cyano-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-chloro-4-methoxyphenyl)-2-cyano-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9334097 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (E)-N-(3-chloro-4-methoxyphenyl)-2-cyano-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2cnn(-c3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C20H15ClN4O2/c1-27-19-8-7-16(10-18(19)21)24-20(26)15(11-22)9-14-12-23-25(13-14)17-5-3-2-4-6-17/h2-10,12-13H,1H3,(H,24,26)/b15-9+ |
| InChIKey | XCKDSFHZIYKWEV-OQLLNIDSSA-N |
| XLogP | 4.08 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|