C19H12Cl2N4O — CID 9334323
(E)-2-cyano-N-(3,5-dichlorophenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 9334323) has the molecular formula C19H12Cl2N4O and a molecular weight of 383.24 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,5-dichlorophenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,5-dichlorophenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9334323 |
| Molecular Formula | C19H12Cl2N4O |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | (E)-2-cyano-N-(3,5-dichlorophenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cnn(-c2ccccc2)c1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N4O/c20-15-7-16(21)9-17(8-15)24-19(26)14(10-22)6-13-11-23-25(12-13)18-4-2-1-3-5-18/h1-9,11-12H,(H,24,26)/b14-6+ |
| InChIKey | IJSLLVMTXLFCKR-MKMNVTDBSA-N |
| XLogP | 4.72 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|