C17H12ClN3O4 — CID 94841564
(Z)-3-(2-chloro-5-nitrophenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 94841564) has the molecular formula C17H12ClN3O4 and a molecular weight of 357.75 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-nitrophenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-nitrophenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 94841564 |
| Molecular Formula | C17H12ClN3O4 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (Z)-3-(2-chloro-5-nitrophenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C17H12ClN3O4/c1-25-15-5-2-13(3-6-15)20-17(22)12(10-19)8-11-9-14(21(23)24)4-7-16(11)18/h2-9H,1H3,(H,20,22)/b12-8- |
| InChIKey | TWNOBYROSIJSKF-WQLSENKSSA-N |
| XLogP | 3.80 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|