C20H14ClN5O4 — CID 17279423
(E)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]prop-2-enamide (PubChem CID 17279423) has the molecular formula C20H14ClN5O4 and a molecular weight of 423.82 g/mol. Its IUPAC name is (E)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17279423 |
| Molecular Formula | C20H14ClN5O4 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (E)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2[nH]ncc2/C=C(\C#N)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C20H14ClN5O4/c1-30-16-5-2-12(3-6-16)19-14(11-23-25-19)8-13(10-22)20(27)24-18-9-15(26(28)29)4-7-17(18)21/h2-9,11H,1H3,(H,23,25)(H,24,27)/b13-8+ |
| InChIKey | SJBDMELCXKSOOF-MDWZMJQESA-N |
| XLogP | 4.19 |
| TPSA | 133.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|