C16H12ClN3OS — CID 17475471
(5E)-3-[(2-chlorophenyl)methyl]-5-(pyridin-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one (PubChem CID 17475471) has the molecular formula C16H12ClN3OS and a molecular weight of 329.81 g/mol. Its IUPAC name is (5E)-3-[(2-chlorophenyl)methyl]-5-(pyridin-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[(2-chlorophenyl)methyl]-5-(pyridin-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 17475471 |
| Molecular Formula | C16H12ClN3OS |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (5E)-3-[(2-chlorophenyl)methyl]-5-(pyridin-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C\c2cccnc2)NC(=S)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C16H12ClN3OS/c17-13-6-2-1-5-12(13)10-20-15(21)14(19-16(20)22)8-11-4-3-7-18-9-11/h1-9H,10H2,(H,19,22)/b14-8+ |
| InChIKey | VCVOSVDONQWCRJ-RIYZIHGNSA-N |
| XLogP | 2.99 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|