C18H12BrClN2O3S — CID 24510429
(5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-3-[(2-chlorophenyl)methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 24510429) has the molecular formula C18H12BrClN2O3S and a molecular weight of 451.73 g/mol. Its IUPAC name is (5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-3-[(2-chlorophenyl)methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-3-[(2-chlorophenyl)methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 24510429 |
| Molecular Formula | C18H12BrClN2O3S |
| Molecular Weight | 451.73 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | (5E)-5-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-3-[(2-chlorophenyl)methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C\c2cc(Br)c3c(c2)OCO3)NC(=S)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H12BrClN2O3S/c19-12-5-10(7-15-16(12)25-9-24-15)6-14-17(23)22(18(26)21-14)8-11-3-1-2-4-13(11)20/h1-7H,8-9H2,(H,21,26)/b14-6+ |
| InChIKey | ZHPBFVIQNHBKEJ-MKMNVTDBSA-N |
| XLogP | 4.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|