C17H15ClN4O3S — CID 33018549
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 33018549) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 33018549 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)N1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C17H15ClN4O3S/c18-15-13(22-8-10-26-17(22)19-15)1-2-14(23)20-4-6-21(7-5-20)16(24)12-3-9-25-11-12/h1-3,8-11H,4-7H2/b2-1+ |
| InChIKey | MYCQLKJXIADDMC-OWOJBTEDSA-N |
| XLogP | 2.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|