C14H16ClN3O2S — CID 77104047
3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(3-hydroxy-3-propylazetidin-1-yl)prop-2-en-1-one (PubChem CID 77104047) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(3-hydroxy-3-propylazetidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(3-hydroxy-3-propylazetidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 77104047 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(3-hydroxy-3-propylazetidin-1-yl)prop-2-en-1-one |
| SMILES | CCCC1(O)CN(C(=O)C=Cc2c(Cl)nc3sccn23)C1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-2-5-14(20)8-17(9-14)11(19)4-3-10-12(15)16-13-18(10)6-7-21-13/h3-4,6-7,20H,2,5,8-9H2,1H3 |
| InChIKey | CWZYZHSBQKANDR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|