C21H23FN6OS — CID 146251672
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-1,3-thiazole-4-carboxamide (PubChem CID 146251672) has the molecular formula C21H23FN6OS and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 146251672 |
| Molecular Formula | C21H23FN6OS |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-1,3-thiazole-4-carboxamide |
| SMILES | C=N/C(=C\C=C(/C)F)CNC(=O)c1csc(CCNCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C21H23FN6OS/c1-14(22)7-8-15(23-2)11-25-21(29)18-13-30-20(28-18)9-10-24-12-19-26-16-5-3-4-6-17(16)27-19/h3-8,13,24H,2,9-12H2,1H3,(H,25,29)(H,26,27)/b14-7+,15-8- |
| InChIKey | FUQOOOKFWDQXHB-GOBHWCIESA-N |
| XLogP | 3.54 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|