C25H29N7OS — CID 163716088
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-piperazin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 163716088) has the molecular formula C25H29N7OS and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-piperazin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-piperazin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 163716088 |
| Molecular Formula | C25H29N7OS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-piperazin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1N1CCNCC1)c1csc(CCNCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C25H29N7OS/c33-25(28-15-18-5-1-4-8-22(18)32-13-11-26-12-14-32)21-17-34-24(31-21)9-10-27-16-23-29-19-6-2-3-7-20(19)30-23/h1-8,17,26-27H,9-16H2,(H,28,33)(H,29,30) |
| InChIKey | KNLOVVOELQBAQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|