C19H20N6OS — CID 157487861
2-[4-(1H-benzimidazol-2-yl)butyl]-N-(1H-imidazol-2-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 157487861) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)butyl]-N-(1H-imidazol-2-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-(1H-imidazol-2-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 157487861 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-(1H-imidazol-2-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ncc[nH]1)c1csc(CCCCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C19H20N6OS/c26-19(22-11-17-20-9-10-21-17)15-12-27-18(25-15)8-4-3-7-16-23-13-5-1-2-6-14(13)24-16/h1-2,5-6,9-10,12H,3-4,7-8,11H2,(H,20,21)(H,22,26)(H,23,24) |
| InChIKey | BWXSWDMPZURRCS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|