C21H27N5OS — CID 158549459
2-[4-(1H-benzimidazol-2-yl)butyl]-N-(piperidin-2-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 158549459) has the molecular formula C21H27N5OS and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)butyl]-N-(piperidin-2-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-(piperidin-2-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 158549459 |
| Molecular Formula | C21H27N5OS |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-(piperidin-2-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCC1CCCCN1)c1csc(CCCCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C21H27N5OS/c27-21(23-13-15-7-5-6-12-22-15)18-14-28-20(26-18)11-4-3-10-19-24-16-8-1-2-9-17(16)25-19/h1-2,8-9,14-15,22H,3-7,10-13H2,(H,23,27)(H,24,25) |
| InChIKey | HPNOGDIIXVNKDL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|