About propylsulfamoyl N-benzylcarbamate
propylsulfamoyl N-benzylcarbamate (PubChem CID 90890692) has the molecular formula C11H16N2O4S
and a molecular weight of 272.33 g/mol. Its IUPAC name is propylsulfamoyl N-benzylcarbamate.
Molecular Properties
| Compound Name | propylsulfamoyl N-benzylcarbamate |
| PubChem CID | 90890692 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | propylsulfamoyl N-benzylcarbamate |
| SMILES | CCCNS(=O)(=O)OC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H16N2O4S/c1-2-8-13-18(15,16)17-11(14)12-9-10-6-4-3-5-7-10/h3-7,13H,2,8-9H2,1H3,(H,12,14) |
| InChIKey | YFPCYYNLASVCFX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propylsulfamoyl N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylsulfamoyl N-benzylcarbamate?
The IUPAC name of propylsulfamoyl N-benzylcarbamate (CID 90890692) is propylsulfamoyl N-benzylcarbamate.
What is the SMILES notation for propylsulfamoyl N-benzylcarbamate?
The canonical SMILES for propylsulfamoyl N-benzylcarbamate is CCCNS(=O)(=O)OC(=O)NCc1ccccc1.
What is the InChIKey of propylsulfamoyl N-benzylcarbamate?
The InChIKey is YFPCYYNLASVCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4S/c1-2-8-13-18(15,16)17-11(14)12-9-10-6-4-3-5-7-10/h3-7,13H,2,8-9H2,1H3,(H,12,14).
What are the key properties of propylsulfamoyl N-benzylcarbamate?
propylsulfamoyl N-benzylcarbamate has a molecular weight of 272.33 g/mol, XLogP of 1.16, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propylsulfamoyl N-benzylcarbamate is sourced from PubChem (CID 90890692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).