C13H20N2O4S — CID 91389428
pentylsulfamoyl N-benzylcarbamate (PubChem CID 91389428) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is pentylsulfamoyl N-benzylcarbamate.
| Compound Name | pentylsulfamoyl N-benzylcarbamate |
|---|---|
| PubChem CID | 91389428 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | pentylsulfamoyl N-benzylcarbamate |
| SMILES | CCCCCNS(=O)(=O)OC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-2-3-7-10-15-20(17,18)19-13(16)14-11-12-8-5-4-6-9-12/h4-6,8-9,15H,2-3,7,10-11H2,1H3,(H,14,16) |
| InChIKey | VTUGEPIXUZULDF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|