C16H22F2N2OS — CID 9283611
1-cyclohexyl-3-[2-[4-(difluoromethoxy)phenyl]ethyl]thiourea (PubChem CID 9283611) has the molecular formula C16H22F2N2OS and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[4-(difluoromethoxy)phenyl]ethyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[2-[4-(difluoromethoxy)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 9283611 |
| Molecular Formula | C16H22F2N2OS |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-cyclohexyl-3-[2-[4-(difluoromethoxy)phenyl]ethyl]thiourea |
| SMILES | FC(F)Oc1ccc(CCNC(=S)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22F2N2OS/c17-15(18)21-14-8-6-12(7-9-14)10-11-19-16(22)20-13-4-2-1-3-5-13/h6-9,13,15H,1-5,10-11H2,(H2,19,20,22) |
| InChIKey | HEMNPFQCYQZAAR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|