C19H23F2N5O2 — CID 55740254
1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea (PubChem CID 55740254) has the molecular formula C19H23F2N5O2 and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55740254 |
| Molecular Formula | C19H23F2N5O2 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
| SMILES | O=C(NCCc1ccc(OC(F)F)cc1)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H23F2N5O2/c20-17(21)28-16-4-2-14(3-5-16)6-11-24-19(27)25-15-7-12-26(13-8-15)18-22-9-1-10-23-18/h1-5,9-10,15,17H,6-8,11-13H2,(H2,24,25,27) |
| InChIKey | RBRCAALFIMWPRY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |