C21H28N6O — CID 55746567
1-(1-pyrimidin-2-ylpiperidin-4-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea (PubChem CID 55746567) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is 1-(1-pyrimidin-2-ylpiperidin-4-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea.
| Compound Name | 1-(1-pyrimidin-2-ylpiperidin-4-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 55746567 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 1-(1-pyrimidin-2-ylpiperidin-4-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(N2CCCC2)cc1)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H28N6O/c28-21(24-16-17-4-6-19(7-5-17)26-12-1-2-13-26)25-18-8-14-27(15-9-18)20-22-10-3-11-23-20/h3-7,10-11,18H,1-2,8-9,12-16H2,(H2,24,25,28) |
| InChIKey | RXZUJXVMFJKSTC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|