C15H23N5OS — CID 75134247
1-pyrazolidin-4-yl-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea (PubChem CID 75134247) has the molecular formula C15H23N5OS and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-pyrazolidin-4-yl-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea.
| Compound Name | 1-pyrazolidin-4-yl-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 75134247 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-pyrazolidin-4-yl-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(N2CCSCC2)cc1)NC1CNNC1 |
| InChI | InChI=1S/C15H23N5OS/c21-15(19-13-10-17-18-11-13)16-9-12-1-3-14(4-2-12)20-5-7-22-8-6-20/h1-4,13,17-18H,5-11H2,(H2,16,19,21) |
| InChIKey | UREFJQWINHTBJV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|