C19H27N3O2S — CID 167820206
1-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea (PubChem CID 167820206) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea.
| Compound Name | 1-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 167820206 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]urea |
| SMILES | CC1OC2(C)CC1(NC(=O)NCc1ccc(N3CCSCC3)cc1)C2 |
| InChI | InChI=1S/C19H27N3O2S/c1-14-19(12-18(2,13-19)24-14)21-17(23)20-11-15-3-5-16(6-4-15)22-7-9-25-10-8-22/h3-6,14H,7-13H2,1-2H3,(H2,20,21,23) |
| InChIKey | NNZIQIDMNHOYRV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|