C21H28N6O4S — CID 55768855
1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea (PubChem CID 55768855) has the molecular formula C21H28N6O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea.
| Compound Name | 1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 55768855 |
| Molecular Formula | C21H28N6O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C21H28N6O4S/c28-21(25-18-3-1-10-26(16-18)20-22-8-2-9-23-20)24-15-17-4-6-19(7-5-17)32(29,30)27-11-13-31-14-12-27/h2,4-9,18H,1,3,10-16H2,(H2,24,25,28) |
| InChIKey | ZTQFUWFAUCKYQO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |