C17H23N5OS — CID 51084671
1-[(5-ethylthiophen-2-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea (PubChem CID 51084671) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 51084671 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
| SMILES | CCc1ccc(CNC(=O)NC2CCCN(c3ncccn3)C2)s1 |
| InChI | InChI=1S/C17H23N5OS/c1-2-14-6-7-15(24-14)11-20-17(23)21-13-5-3-10-22(12-13)16-18-8-4-9-19-16/h4,6-9,13H,2-3,5,10-12H2,1H3,(H2,20,21,23) |
| InChIKey | LTSNXUOPLQSNAJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |