C17H28N6O2 — CID 51089111
N-butan-2-yl-3-[(1-pyrimidin-2-ylpiperidin-3-yl)carbamoylamino]propanamide (PubChem CID 51089111) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-butan-2-yl-3-[(1-pyrimidin-2-ylpiperidin-3-yl)carbamoylamino]propanamide.
| Compound Name | N-butan-2-yl-3-[(1-pyrimidin-2-ylpiperidin-3-yl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 51089111 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-butan-2-yl-3-[(1-pyrimidin-2-ylpiperidin-3-yl)carbamoylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C17H28N6O2/c1-3-13(2)21-15(24)7-10-20-17(25)22-14-6-4-11-23(12-14)16-18-8-5-9-19-16/h5,8-9,13-14H,3-4,6-7,10-12H2,1-2H3,(H,21,24)(H2,20,22,25) |
| InChIKey | SUXLGWRGWGPSFK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |