C19H28N6O — CID 56887725
1-ethyl-3-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrazole-5-carboxamide (PubChem CID 56887725) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrazole-5-carboxamide.
| Compound Name | 1-ethyl-3-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 56887725 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-ethyl-3-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrazole-5-carboxamide |
| SMILES | CCn1nc(CC(C)C)cc1C(=O)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C19H28N6O/c1-4-25-17(12-16(23-25)11-14(2)3)18(26)22-15-7-5-10-24(13-15)19-20-8-6-9-21-19/h6,8-9,12,14-15H,4-5,7,10-11,13H2,1-3H3,(H,22,26) |
| InChIKey | CIOJEGLRCXHBJD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |