C19H26N6O — CID 45184903
2-methyl-6-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrimidine-4-carboxamide (PubChem CID 45184903) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-methyl-6-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-methyl-6-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 45184903 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-methyl-6-(2-methylpropyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(CC(C)C)cc(C(=O)NC2CCCN(c3ncccn3)C2)n1 |
| InChI | InChI=1S/C19H26N6O/c1-13(2)10-16-11-17(23-14(3)22-16)18(26)24-15-6-4-9-25(12-15)19-20-7-5-8-21-19/h5,7-8,11,13,15H,4,6,9-10,12H2,1-3H3,(H,24,26) |
| InChIKey | LRNRKRVBDZKTND-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |