C14H25Cl2N5O — CID 120503187
3-amino-2-methyl-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide;dihydrochloride (PubChem CID 120503187) has the molecular formula C14H25Cl2N5O and a molecular weight of 350.29 g/mol. Its IUPAC name is 3-amino-2-methyl-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide;dihydrochloride.
| Compound Name | 3-amino-2-methyl-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120503187 |
| Molecular Formula | C14H25Cl2N5O |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-amino-2-methyl-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)NC1CCCN(c2ncccn2)C1.Cl.Cl |
| InChI | InChI=1S/C14H23N5O.2ClH/c1-10(11(2)15)13(20)18-12-5-3-8-19(9-12)14-16-6-4-7-17-14;;/h4,6-7,10-12H,3,5,8-9,15H2,1-2H3,(H,18,20);2*1H |
| InChIKey | MRXKCQKSZASMGE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |