C13H20N4OS — CID 42463878
3-methylsulfanyl-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]propanamide (PubChem CID 42463878) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 3-methylsulfanyl-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]propanamide.
| Compound Name | 3-methylsulfanyl-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 42463878 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-methylsulfanyl-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]propanamide |
| SMILES | CSCCC(=O)N[C@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C13H20N4OS/c1-19-9-5-12(18)16-11-4-2-8-17(10-11)13-14-6-3-7-15-13/h3,6-7,11H,2,4-5,8-10H2,1H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | VWWFALHACOLCOF-NSHDSACASA-N |
| XLogP | 1.31 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |